C23H26ClN3O4 — CID 55653577
1-[2-[(2-chlorobenzoyl)amino]propanoyl]-N-(2-methoxyphenyl)piperidine-4-carboxamide (PubChem CID 55653577) has the molecular formula C23H26ClN3O4 and a molecular weight of 443.93 g/mol. Its IUPAC name is 1-[2-[(2-chlorobenzoyl)amino]propanoyl]-N-(2-methoxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-[(2-chlorobenzoyl)amino]propanoyl]-N-(2-methoxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55653577 |
| Molecular Formula | C23H26ClN3O4 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 1-[2-[(2-chlorobenzoyl)amino]propanoyl]-N-(2-methoxyphenyl)piperidine-4-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1CCN(C(=O)C(C)NC(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C23H26ClN3O4/c1-15(25-22(29)17-7-3-4-8-18(17)24)23(30)27-13-11-16(12-14-27)21(28)26-19-9-5-6-10-20(19)31-2/h3-10,15-16H,11-14H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | MMLPVOSQHGGNLM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |