C19H22N4O4S — CID 55655477
N-[3-[[acetyl(ethyl)amino]methyl]phenyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide (PubChem CID 55655477) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is N-[3-[[acetyl(ethyl)amino]methyl]phenyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide.
| Compound Name | N-[3-[[acetyl(ethyl)amino]methyl]phenyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
|---|---|
| PubChem CID | 55655477 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-[3-[[acetyl(ethyl)amino]methyl]phenyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
| SMILES | CCN(Cc1cccc(NC(=O)C2=CC=CN3CCS(=O)(=O)N=C23)c1)C(C)=O |
| InChI | InChI=1S/C19H22N4O4S/c1-3-22(14(2)24)13-15-6-4-7-16(12-15)20-19(25)17-8-5-9-23-10-11-28(26,27)21-18(17)23/h4-9,12H,3,10-11,13H2,1-2H3,(H,20,25) |
| InChIKey | DDYNRYFHERXKJG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |