C23H23N5O4S — CID 55817286
N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide (PubChem CID 55817286) has the molecular formula C23H23N5O4S and a molecular weight of 465.54 g/mol. Its IUPAC name is N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide.
| Compound Name | N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
|---|---|
| PubChem CID | 55817286 |
| Molecular Formula | C23H23N5O4S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
| SMILES | Cc1cccc(NC(=O)Nc2cccc(CNC(=O)C3=CC=CN4CCS(=O)(=O)N=C34)c2)c1 |
| InChI | InChI=1S/C23H23N5O4S/c1-16-5-2-7-18(13-16)25-23(30)26-19-8-3-6-17(14-19)15-24-22(29)20-9-4-10-28-11-12-33(31,32)27-21(20)28/h2-10,13-14H,11-12,15H2,1H3,(H,24,29)(H2,25,26,30) |
| InChIKey | PBJUULTVGAJVPA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |