C22H31ClN4O2 — CID 119719678
7-amino-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]heptanamide;hydrochloride (PubChem CID 119719678) has the molecular formula C22H31ClN4O2 and a molecular weight of 418.97 g/mol. Its IUPAC name is 7-amino-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119719678 |
| Molecular Formula | C22H31ClN4O2 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 7-amino-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]heptanamide;hydrochloride |
| SMILES | Cc1cccc(NC(=O)Nc2cccc(CNC(=O)CCCCCCN)c2)c1.Cl |
| InChI | InChI=1S/C22H30N4O2.ClH/c1-17-8-6-10-19(14-17)25-22(28)26-20-11-7-9-18(15-20)16-24-21(27)12-4-2-3-5-13-23;/h6-11,14-15H,2-5,12-13,16,23H2,1H3,(H,24,27)(H2,25,26,28);1H |
| InChIKey | SYXBBHPCNDKHPZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|