C24H20ClN3O3 — CID 55659317
2-chloro-N-[2-[[2-(9-oxoacridin-10-yl)acetyl]amino]ethyl]benzamide (PubChem CID 55659317) has the molecular formula C24H20ClN3O3 and a molecular weight of 433.90 g/mol. Its IUPAC name is 2-chloro-N-[2-[[2-(9-oxoacridin-10-yl)acetyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[2-(9-oxoacridin-10-yl)acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55659317 |
| Molecular Formula | C24H20ClN3O3 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2-chloro-N-[2-[[2-(9-oxoacridin-10-yl)acetyl]amino]ethyl]benzamide |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C24H20ClN3O3/c25-19-10-4-1-7-16(19)24(31)27-14-13-26-22(29)15-28-20-11-5-2-8-17(20)23(30)18-9-3-6-12-21(18)28/h1-12H,13-15H2,(H,26,29)(H,27,31) |
| InChIKey | KIIJUNAQMITFIN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|