C23H18Cl2N2O3 — CID 99810576
N-[(2R)-2-(2,6-dichlorophenyl)-2-hydroxyethyl]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 99810576) has the molecular formula C23H18Cl2N2O3 and a molecular weight of 441.31 g/mol. Its IUPAC name is N-[(2R)-2-(2,6-dichlorophenyl)-2-hydroxyethyl]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[(2R)-2-(2,6-dichlorophenyl)-2-hydroxyethyl]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 99810576 |
| Molecular Formula | C23H18Cl2N2O3 |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | N-[(2R)-2-(2,6-dichlorophenyl)-2-hydroxyethyl]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)NC[C@H](O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H18Cl2N2O3/c24-16-8-5-9-17(25)22(16)20(28)12-26-21(29)13-27-18-10-3-1-6-14(18)23(30)15-7-2-4-11-19(15)27/h1-11,20,28H,12-13H2,(H,26,29)/t20-/m0/s1 |
| InChIKey | SOOVHIBFUJAVSH-FQEVSTJZSA-N |
| XLogP | 4.31 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|