C19H19ClN2O3 — CID 55659427
2-chloro-N-[2-[[2-(2,3-dihydro-1-benzofuran-5-yl)acetyl]amino]ethyl]benzamide (PubChem CID 55659427) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is 2-chloro-N-[2-[[2-(2,3-dihydro-1-benzofuran-5-yl)acetyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[2-(2,3-dihydro-1-benzofuran-5-yl)acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55659427 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-chloro-N-[2-[[2-(2,3-dihydro-1-benzofuran-5-yl)acetyl]amino]ethyl]benzamide |
| SMILES | O=C(Cc1ccc2c(c1)CCO2)NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C19H19ClN2O3/c20-16-4-2-1-3-15(16)19(24)22-9-8-21-18(23)12-13-5-6-17-14(11-13)7-10-25-17/h1-6,11H,7-10,12H2,(H,21,23)(H,22,24) |
| InChIKey | NHUQLUMHIUZMIF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|