C22H26N2O6S2 — CID 55667992
methyl 5-[4-(4-phenyloxane-4-carbonyl)piperazin-1-yl]sulfonylthiophene-3-carboxylate (PubChem CID 55667992) has the molecular formula C22H26N2O6S2 and a molecular weight of 478.59 g/mol. Its IUPAC name is methyl 5-[4-(4-phenyloxane-4-carbonyl)piperazin-1-yl]sulfonylthiophene-3-carboxylate.
| Compound Name | methyl 5-[4-(4-phenyloxane-4-carbonyl)piperazin-1-yl]sulfonylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 55667992 |
| Molecular Formula | C22H26N2O6S2 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | methyl 5-[4-(4-phenyloxane-4-carbonyl)piperazin-1-yl]sulfonylthiophene-3-carboxylate |
| SMILES | COC(=O)c1csc(S(=O)(=O)N2CCN(C(=O)C3(c4ccccc4)CCOCC3)CC2)c1 |
| InChI | InChI=1S/C22H26N2O6S2/c1-29-20(25)17-15-19(31-16-17)32(27,28)24-11-9-23(10-12-24)21(26)22(7-13-30-14-8-22)18-5-3-2-4-6-18/h2-6,15-16H,7-14H2,1H3 |
| InChIKey | DVQHIYLPVHRKRA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |