C20H25N3O5S2 — CID 50777841
[5-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylthiophen-3-yl]-morpholin-4-ylmethanone (PubChem CID 50777841) has the molecular formula C20H25N3O5S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is [5-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylthiophen-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [5-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylthiophen-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 50777841 |
| Molecular Formula | C20H25N3O5S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | [5-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylthiophen-3-yl]-morpholin-4-ylmethanone |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)c3cc(C(=O)N4CCOCC4)cs3)CC2)cc1 |
| InChI | InChI=1S/C20H25N3O5S2/c1-27-18-4-2-17(3-5-18)21-6-8-23(9-7-21)30(25,26)19-14-16(15-29-19)20(24)22-10-12-28-13-11-22/h2-5,14-15H,6-13H2,1H3 |
| InChIKey | UKZMIRJCHJWRKZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|