C22H30N4O5S — CID 53005346
(3,5-dimethyl-4-morpholin-4-ylsulfonyl-1H-pyrrol-2-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 53005346) has the molecular formula C22H30N4O5S and a molecular weight of 462.57 g/mol. Its IUPAC name is (3,5-dimethyl-4-morpholin-4-ylsulfonyl-1H-pyrrol-2-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | (3,5-dimethyl-4-morpholin-4-ylsulfonyl-1H-pyrrol-2-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 53005346 |
| Molecular Formula | C22H30N4O5S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | (3,5-dimethyl-4-morpholin-4-ylsulfonyl-1H-pyrrol-2-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)c3[nH]c(C)c(S(=O)(=O)N4CCOCC4)c3C)CC2)cc1 |
| InChI | InChI=1S/C22H30N4O5S/c1-16-20(23-17(2)21(16)32(28,29)26-12-14-31-15-13-26)22(27)25-10-8-24(9-11-25)18-4-6-19(30-3)7-5-18/h4-7,23H,8-15H2,1-3H3 |
| InChIKey | HCBHQMGNBIVBJA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|