C22H24N4O4S — CID 55669945
N-(4-cyclopentylsulfonylphenyl)-1-(3-methoxyphenyl)-5-methyltriazole-4-carboxamide (PubChem CID 55669945) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is N-(4-cyclopentylsulfonylphenyl)-1-(3-methoxyphenyl)-5-methyltriazole-4-carboxamide.
| Compound Name | N-(4-cyclopentylsulfonylphenyl)-1-(3-methoxyphenyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 55669945 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-(4-cyclopentylsulfonylphenyl)-1-(3-methoxyphenyl)-5-methyltriazole-4-carboxamide |
| SMILES | COc1cccc(-n2nnc(C(=O)Nc3ccc(S(=O)(=O)C4CCCC4)cc3)c2C)c1 |
| InChI | InChI=1S/C22H24N4O4S/c1-15-21(24-25-26(15)17-6-5-7-18(14-17)30-2)22(27)23-16-10-12-20(13-11-16)31(28,29)19-8-3-4-9-19/h5-7,10-14,19H,3-4,8-9H2,1-2H3,(H,23,27) |
| InChIKey | JXUZIKRCAWDFMU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |