C19H18BrN5O3 — CID 55878500
N-[2-(4-bromoanilino)-2-oxoethyl]-1-(3-methoxyphenyl)-5-methyltriazole-4-carboxamide (PubChem CID 55878500) has the molecular formula C19H18BrN5O3 and a molecular weight of 444.29 g/mol. Its IUPAC name is N-[2-(4-bromoanilino)-2-oxoethyl]-1-(3-methoxyphenyl)-5-methyltriazole-4-carboxamide.
| Compound Name | N-[2-(4-bromoanilino)-2-oxoethyl]-1-(3-methoxyphenyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 55878500 |
| Molecular Formula | C19H18BrN5O3 |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | N-[2-(4-bromoanilino)-2-oxoethyl]-1-(3-methoxyphenyl)-5-methyltriazole-4-carboxamide |
| SMILES | COc1cccc(-n2nnc(C(=O)NCC(=O)Nc3ccc(Br)cc3)c2C)c1 |
| InChI | InChI=1S/C19H18BrN5O3/c1-12-18(23-24-25(12)15-4-3-5-16(10-15)28-2)19(27)21-11-17(26)22-14-8-6-13(20)7-9-14/h3-10H,11H2,1-2H3,(H,21,27)(H,22,26) |
| InChIKey | AIPKTHKLWMHEMO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |