C20H21N5O5 — CID 55648326
N'-(3,4-dimethoxybenzoyl)-1-(3-methoxyphenyl)-5-methyltriazole-4-carbohydrazide (PubChem CID 55648326) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is N'-(3,4-dimethoxybenzoyl)-1-(3-methoxyphenyl)-5-methyltriazole-4-carbohydrazide.
| Compound Name | N'-(3,4-dimethoxybenzoyl)-1-(3-methoxyphenyl)-5-methyltriazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55648326 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | N'-(3,4-dimethoxybenzoyl)-1-(3-methoxyphenyl)-5-methyltriazole-4-carbohydrazide |
| SMILES | COc1cccc(-n2nnc(C(=O)NNC(=O)c3ccc(OC)c(OC)c3)c2C)c1 |
| InChI | InChI=1S/C20H21N5O5/c1-12-18(21-24-25(12)14-6-5-7-15(11-14)28-2)20(27)23-22-19(26)13-8-9-16(29-3)17(10-13)30-4/h5-11H,1-4H3,(H,22,26)(H,23,27) |
| InChIKey | ZWJDQFRNJALKIC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|