C18H22N6O2 — CID 55976309
N-(5-tert-butyl-1H-pyrazol-3-yl)-1-(3-methoxyphenyl)-5-methyltriazole-4-carboxamide (PubChem CID 55976309) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-(5-tert-butyl-1H-pyrazol-3-yl)-1-(3-methoxyphenyl)-5-methyltriazole-4-carboxamide.
| Compound Name | N-(5-tert-butyl-1H-pyrazol-3-yl)-1-(3-methoxyphenyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 55976309 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | N-(5-tert-butyl-1H-pyrazol-3-yl)-1-(3-methoxyphenyl)-5-methyltriazole-4-carboxamide |
| SMILES | COc1cccc(-n2nnc(C(=O)Nc3cc(C(C)(C)C)[nH]n3)c2C)c1 |
| InChI | InChI=1S/C18H22N6O2/c1-11-16(17(25)19-15-10-14(20-21-15)18(2,3)4)22-23-24(11)12-7-6-8-13(9-12)26-5/h6-10H,1-5H3,(H2,19,20,21,25) |
| InChIKey | PVTSCXHZAHSGAB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |