C21H20N4O5S — CID 55671970
N-[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide (PubChem CID 55671970) has the molecular formula C21H20N4O5S and a molecular weight of 440.48 g/mol. Its IUPAC name is N-[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide.
| Compound Name | N-[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
|---|---|
| PubChem CID | 55671970 |
| Molecular Formula | C21H20N4O5S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | N-[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
| SMILES | COc1ccc(NC(=O)C2=CC=CN3CCS(=O)(=O)N=C23)cc1OCc1ccncc1 |
| InChI | InChI=1S/C21H20N4O5S/c1-29-18-5-4-16(13-19(18)30-14-15-6-8-22-9-7-15)23-21(26)17-3-2-10-25-11-12-31(27,28)24-20(17)25/h2-10,13H,11-12,14H2,1H3,(H,23,26) |
| InChIKey | VGXCYVCWZXHCSZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |