C9H12O3 — CID 556725
1-methoxy-5-methyl-1,3a,4,6a-tetrahydrocyclopenta[c]furan-3-one (PubChem CID 556725) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 1-methoxy-5-methyl-1,3a,4,6a-tetrahydrocyclopenta[c]furan-3-one.
| Compound Name | 1-methoxy-5-methyl-1,3a,4,6a-tetrahydrocyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 556725 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 1-methoxy-5-methyl-1,3a,4,6a-tetrahydrocyclopenta[c]furan-3-one |
| SMILES | COC1OC(=O)C2CC(C)=CC12 |
| InChI | InChI=1S/C9H12O3/c1-5-3-6-7(4-5)9(11-2)12-8(6)10/h4,6-7,9H,3H2,1-2H3 |
| InChIKey | MGFJEBOFIUPFCT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|