C21H25N3O5S — CID 55678336
(E)-3-[4-(ethylsulfamoyl)phenyl]-N-[1-(furan-2-carbonyl)piperidin-4-yl]prop-2-enamide (PubChem CID 55678336) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is (E)-3-[4-(ethylsulfamoyl)phenyl]-N-[1-(furan-2-carbonyl)piperidin-4-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-(ethylsulfamoyl)phenyl]-N-[1-(furan-2-carbonyl)piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55678336 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (E)-3-[4-(ethylsulfamoyl)phenyl]-N-[1-(furan-2-carbonyl)piperidin-4-yl]prop-2-enamide |
| SMILES | CCNS(=O)(=O)c1ccc(/C=C/C(=O)NC2CCN(C(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C21H25N3O5S/c1-2-22-30(27,28)18-8-5-16(6-9-18)7-10-20(25)23-17-11-13-24(14-12-17)21(26)19-4-3-15-29-19/h3-10,15,17,22H,2,11-14H2,1H3,(H,23,25)/b10-7+ |
| InChIKey | OPYNZKNJZFXCRU-JXMROGBWSA-N |
| XLogP | 2.01 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|