C24H29N3O7S — CID 6215811
[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate (PubChem CID 6215811) has the molecular formula C24H29N3O7S and a molecular weight of 503.58 g/mol. Its IUPAC name is [2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate.
| Compound Name | [2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 6215811 |
| Molecular Formula | C24H29N3O7S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | [2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)OCC(=O)N2CCN(C(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C24H29N3O7S/c1-3-27(4-2)35(31,32)20-10-7-19(8-11-20)9-12-23(29)34-18-22(28)25-13-15-26(16-14-25)24(30)21-6-5-17-33-21/h5-12,17H,3-4,13-16,18H2,1-2H3/b12-9+ |
| InChIKey | RTAOKZRPPKHAFZ-FMIVXFBMSA-N |
| XLogP | 1.85 |
| TPSA | 117.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|