C26H30FN5O2 — CID 55680640
[2-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethylamino]quinolin-4-yl]-morpholin-4-ylmethanone (PubChem CID 55680640) has the molecular formula C26H30FN5O2 and a molecular weight of 463.56 g/mol. Its IUPAC name is [2-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethylamino]quinolin-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethylamino]quinolin-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 55680640 |
| Molecular Formula | C26H30FN5O2 |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | [2-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethylamino]quinolin-4-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cc(NCCN2CCN(c3ccc(F)cc3)CC2)nc2ccccc12)N1CCOCC1 |
| InChI | InChI=1S/C26H30FN5O2/c27-20-5-7-21(8-6-20)31-13-11-30(12-14-31)10-9-28-25-19-23(22-3-1-2-4-24(22)29-25)26(33)32-15-17-34-18-16-32/h1-8,19H,9-18H2,(H,28,29) |
| InChIKey | KACJZOWQKYLQBJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |