C26H23FN4O3 — CID 55829912
[2-[[6-(4-fluorophenoxy)-3-pyridinyl]methylamino]quinolin-4-yl]-morpholin-4-ylmethanone (PubChem CID 55829912) has the molecular formula C26H23FN4O3 and a molecular weight of 458.49 g/mol. Its IUPAC name is [2-[[6-(4-fluorophenoxy)-3-pyridinyl]methylamino]quinolin-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-[[6-(4-fluorophenoxy)-3-pyridinyl]methylamino]quinolin-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 55829912 |
| Molecular Formula | C26H23FN4O3 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | [2-[[6-(4-fluorophenoxy)-3-pyridinyl]methylamino]quinolin-4-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cc(NCc2ccc(Oc3ccc(F)cc3)nc2)nc2ccccc12)N1CCOCC1 |
| InChI | InChI=1S/C26H23FN4O3/c27-19-6-8-20(9-7-19)34-25-10-5-18(17-29-25)16-28-24-15-22(21-3-1-2-4-23(21)30-24)26(32)31-11-13-33-14-12-31/h1-10,15,17H,11-14,16H2,(H,28,30) |
| InChIKey | ZBIJRNRSQWORMA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |