C18H25N5O4S — CID 55681332
methyl 1-[[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]methyl]triazole-4-carboxylate (PubChem CID 55681332) has the molecular formula C18H25N5O4S and a molecular weight of 407.50 g/mol. Its IUPAC name is methyl 1-[[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]methyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 55681332 |
| Molecular Formula | C18H25N5O4S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | methyl 1-[[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]methyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(CN2CCN(S(=O)(=O)c3ccc(C(C)C)cc3)CC2)nn1 |
| InChI | InChI=1S/C18H25N5O4S/c1-14(2)15-4-6-16(7-5-15)28(25,26)23-10-8-21(9-11-23)13-22-12-17(19-20-22)18(24)27-3/h4-7,12,14H,8-11,13H2,1-3H3 |
| InChIKey | CAKANQZIGBQQRT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |