C20H22N4O4S — CID 55681981
2-oxo-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3,4-dihydro-1H-quinoline-6-sulfonamide (PubChem CID 55681981) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is 2-oxo-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3,4-dihydro-1H-quinoline-6-sulfonamide.
| Compound Name | 2-oxo-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3,4-dihydro-1H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 55681981 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-oxo-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3,4-dihydro-1H-quinoline-6-sulfonamide |
| SMILES | O=C1CN(c2ccc(CNS(=O)(=O)c3ccc4c(c3)CCC(=O)N4)cc2)CCN1 |
| InChI | InChI=1S/C20H22N4O4S/c25-19-8-3-15-11-17(6-7-18(15)23-19)29(27,28)22-12-14-1-4-16(5-2-14)24-10-9-21-20(26)13-24/h1-2,4-7,11,22H,3,8-10,12-13H2,(H,21,26)(H,23,25) |
| InChIKey | LXQGPGTZUAJCEK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|