C23H29N3O4 — CID 55683744
N-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]-4-(4-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 55683744) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is N-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]-4-(4-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | N-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]-4-(4-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55683744 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | N-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethyl]-4-(4-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)NC(C)c3ccc4c(c3)OCCCO4)CC2)cc1 |
| InChI | InChI=1S/C23H29N3O4/c1-17(18-4-9-21-22(16-18)30-15-3-14-29-21)24-23(27)26-12-10-25(11-13-26)19-5-7-20(28-2)8-6-19/h4-9,16-17H,3,10-15H2,1-2H3,(H,24,27) |
| InChIKey | PFOJBHODWCFMNR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|