C21H24F3N3O2 — CID 55684140
1-[(2-cyclopentyloxy-4-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 55684140) has the molecular formula C21H24F3N3O2 and a molecular weight of 407.44 g/mol. Its IUPAC name is 1-[(2-cyclopentyloxy-4-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-[(2-cyclopentyloxy-4-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 55684140 |
| Molecular Formula | C21H24F3N3O2 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 1-[(2-cyclopentyloxy-4-pyridinyl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | O=C(NCCc1ccc(C(F)(F)F)cc1)NCc1ccnc(OC2CCCC2)c1 |
| InChI | InChI=1S/C21H24F3N3O2/c22-21(23,24)17-7-5-15(6-8-17)9-12-26-20(28)27-14-16-10-11-25-19(13-16)29-18-3-1-2-4-18/h5-8,10-11,13,18H,1-4,9,12,14H2,(H2,26,27,28) |
| InChIKey | WNMROOVOHHSRBK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |