C14H20N2O4S — CID 55684408
N'-[2-(2-ethoxyphenoxy)acetyl]-2-methylsulfanylpropanehydrazide (PubChem CID 55684408) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is N'-[2-(2-ethoxyphenoxy)acetyl]-2-methylsulfanylpropanehydrazide.
| Compound Name | N'-[2-(2-ethoxyphenoxy)acetyl]-2-methylsulfanylpropanehydrazide |
|---|---|
| PubChem CID | 55684408 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N'-[2-(2-ethoxyphenoxy)acetyl]-2-methylsulfanylpropanehydrazide |
| SMILES | CCOc1ccccc1OCC(=O)NNC(=O)C(C)SC |
| InChI | InChI=1S/C14H20N2O4S/c1-4-19-11-7-5-6-8-12(11)20-9-13(17)15-16-14(18)10(2)21-3/h5-8,10H,4,9H2,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | JMBZZRCOBMCYOM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|