C23H29N3O6 — CID 55944322
benzyl N-[(2S)-1-[2-[2-(2-ethoxyphenoxy)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 55944322) has the molecular formula C23H29N3O6 and a molecular weight of 443.50 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[2-[2-(2-ethoxyphenoxy)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[2-[2-(2-ethoxyphenoxy)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 55944322 |
| Molecular Formula | C23H29N3O6 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | benzyl N-[(2S)-1-[2-[2-(2-ethoxyphenoxy)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCOc1ccccc1OCC(=O)NNC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C23H29N3O6/c1-4-30-18-12-8-9-13-19(18)31-15-20(27)25-26-22(28)21(16(2)3)24-23(29)32-14-17-10-6-5-7-11-17/h5-13,16,21H,4,14-15H2,1-3H3,(H,24,29)(H,25,27)(H,26,28)/t21-/m0/s1 |
| InChIKey | AUUHVXYPSDQCRE-NRFANRHFSA-N |
| XLogP | 2.56 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|