C21H24N2O3S — CID 55684571
ethyl 1-[4-(pyridin-3-ylmethylsulfanyl)benzoyl]piperidine-3-carboxylate (PubChem CID 55684571) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is ethyl 1-[4-(pyridin-3-ylmethylsulfanyl)benzoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[4-(pyridin-3-ylmethylsulfanyl)benzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 55684571 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | ethyl 1-[4-(pyridin-3-ylmethylsulfanyl)benzoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2ccc(SCc3cccnc3)cc2)C1 |
| InChI | InChI=1S/C21H24N2O3S/c1-2-26-21(25)18-6-4-12-23(14-18)20(24)17-7-9-19(10-8-17)27-15-16-5-3-11-22-13-16/h3,5,7-11,13,18H,2,4,6,12,14-15H2,1H3 |
| InChIKey | GYWWWNRKXNJJEH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |