C23H35N3O4S — CID 55687508
1-(2-methylpiperidin-1-yl)-2-[4-[2-(3-phenylpropylsulfonyl)acetyl]piperazin-1-yl]ethanone (PubChem CID 55687508) has the molecular formula C23H35N3O4S and a molecular weight of 449.62 g/mol. Its IUPAC name is 1-(2-methylpiperidin-1-yl)-2-[4-[2-(3-phenylpropylsulfonyl)acetyl]piperazin-1-yl]ethanone.
| Compound Name | 1-(2-methylpiperidin-1-yl)-2-[4-[2-(3-phenylpropylsulfonyl)acetyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55687508 |
| Molecular Formula | C23H35N3O4S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 1-(2-methylpiperidin-1-yl)-2-[4-[2-(3-phenylpropylsulfonyl)acetyl]piperazin-1-yl]ethanone |
| SMILES | CC1CCCCN1C(=O)CN1CCN(C(=O)CS(=O)(=O)CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H35N3O4S/c1-20-8-5-6-12-26(20)22(27)18-24-13-15-25(16-14-24)23(28)19-31(29,30)17-7-11-21-9-3-2-4-10-21/h2-4,9-10,20H,5-8,11-19H2,1H3 |
| InChIKey | YHOWLTPOLLBGKK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |