C23H29NO3S — CID 55466903
1-(4-benzylpiperidin-1-yl)-2-(3-phenylpropylsulfonyl)ethanone (PubChem CID 55466903) has the molecular formula C23H29NO3S and a molecular weight of 399.56 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-2-(3-phenylpropylsulfonyl)ethanone.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-2-(3-phenylpropylsulfonyl)ethanone |
|---|---|
| PubChem CID | 55466903 |
| Molecular Formula | C23H29NO3S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-2-(3-phenylpropylsulfonyl)ethanone |
| SMILES | O=C(CS(=O)(=O)CCCc1ccccc1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H29NO3S/c25-23(19-28(26,27)17-7-12-20-8-3-1-4-9-20)24-15-13-22(14-16-24)18-21-10-5-2-6-11-21/h1-6,8-11,22H,7,12-19H2 |
| InChIKey | MGWXMZIHCJRBOJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |