C22H24F3NO3S — CID 78852439
1-(4-benzylpiperidin-1-yl)-2-[[2-(trifluoromethyl)phenyl]methylsulfonyl]ethanone (PubChem CID 78852439) has the molecular formula C22H24F3NO3S and a molecular weight of 439.50 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-2-[[2-(trifluoromethyl)phenyl]methylsulfonyl]ethanone.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-2-[[2-(trifluoromethyl)phenyl]methylsulfonyl]ethanone |
|---|---|
| PubChem CID | 78852439 |
| Molecular Formula | C22H24F3NO3S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-2-[[2-(trifluoromethyl)phenyl]methylsulfonyl]ethanone |
| SMILES | O=C(CS(=O)(=O)Cc1ccccc1C(F)(F)F)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H24F3NO3S/c23-22(24,25)20-9-5-4-8-19(20)15-30(28,29)16-21(27)26-12-10-18(11-13-26)14-17-6-2-1-3-7-17/h1-9,18H,10-16H2 |
| InChIKey | CIZMLPOJHQVVSD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |