C22H21FN4O2 — CID 55687781
N'-(4-ethylbenzoyl)-1-(2-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbohydrazide (PubChem CID 55687781) has the molecular formula C22H21FN4O2 and a molecular weight of 392.43 g/mol. Its IUPAC name is N'-(4-ethylbenzoyl)-1-(2-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbohydrazide.
| Compound Name | N'-(4-ethylbenzoyl)-1-(2-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 55687781 |
| Molecular Formula | C22H21FN4O2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N'-(4-ethylbenzoyl)-1-(2-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carbohydrazide |
| SMILES | CCc1ccc(C(=O)NNC(=O)c2nn(-c3ccccc3F)c3c2CCC3)cc1 |
| InChI | InChI=1S/C22H21FN4O2/c1-2-14-10-12-15(13-11-14)21(28)24-25-22(29)20-16-6-5-9-18(16)27(26-20)19-8-4-3-7-17(19)23/h3-4,7-8,10-13H,2,5-6,9H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | KBRFXOAKRHWRGW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|