C22H29N5O3 — CID 55688968
2-methyl-N-[1-[2-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)acetyl]piperidin-4-yl]benzamide (PubChem CID 55688968) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-methyl-N-[1-[2-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)acetyl]piperidin-4-yl]benzamide.
| Compound Name | 2-methyl-N-[1-[2-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)acetyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 55688968 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 2-methyl-N-[1-[2-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)acetyl]piperidin-4-yl]benzamide |
| SMILES | Cc1ccccc1C(=O)NC1CCN(C(=O)Cn2nc3n(c2=O)CCCCC3)CC1 |
| InChI | InChI=1S/C22H29N5O3/c1-16-7-4-5-8-18(16)21(29)23-17-10-13-25(14-11-17)20(28)15-27-22(30)26-12-6-2-3-9-19(26)24-27/h4-5,7-8,17H,2-3,6,9-15H2,1H3,(H,23,29) |
| InChIKey | YFXINMXOVVHOQI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |