C20H23Cl2N5O3 — CID 55752160
2-[2-[4-(2,3-dichlorobenzoyl)piperazin-1-yl]-2-oxoethyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-one (PubChem CID 55752160) has the molecular formula C20H23Cl2N5O3 and a molecular weight of 452.34 g/mol. Its IUPAC name is 2-[2-[4-(2,3-dichlorobenzoyl)piperazin-1-yl]-2-oxoethyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-one.
| Compound Name | 2-[2-[4-(2,3-dichlorobenzoyl)piperazin-1-yl]-2-oxoethyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-one |
|---|---|
| PubChem CID | 55752160 |
| Molecular Formula | C20H23Cl2N5O3 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 2-[2-[4-(2,3-dichlorobenzoyl)piperazin-1-yl]-2-oxoethyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-one |
| SMILES | O=C(Cn1nc2n(c1=O)CCCCC2)N1CCN(C(=O)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C20H23Cl2N5O3/c21-15-6-4-5-14(18(15)22)19(29)25-11-9-24(10-12-25)17(28)13-27-20(30)26-8-3-1-2-7-16(26)23-27/h4-6H,1-3,7-13H2 |
| InChIKey | CSSOVWCEWHWIOO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 80.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |