C19H23F2N5O4S — CID 55583567
2-[2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-one (PubChem CID 55583567) has the molecular formula C19H23F2N5O4S and a molecular weight of 455.49 g/mol. Its IUPAC name is 2-[2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-one.
| Compound Name | 2-[2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-one |
|---|---|
| PubChem CID | 55583567 |
| Molecular Formula | C19H23F2N5O4S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 2-[2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-one |
| SMILES | O=C(Cn1nc2n(c1=O)CCCCC2)N1CCN(S(=O)(=O)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C19H23F2N5O4S/c20-14-5-4-6-15(21)18(14)31(29,30)24-11-9-23(10-12-24)17(27)13-26-19(28)25-8-3-1-2-7-16(25)22-26/h4-6H,1-3,7-13H2 |
| InChIKey | RFDQRKHOIFTJMW-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 97.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |