C26H38N2O3 — CID 55689710
N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-4-[4-(2-methylpropyl)phenyl]-4-oxobutanamide (PubChem CID 55689710) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-4-[4-(2-methylpropyl)phenyl]-4-oxobutanamide.
| Compound Name | N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-4-[4-(2-methylpropyl)phenyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 55689710 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-4-[4-(2-methylpropyl)phenyl]-4-oxobutanamide |
| SMILES | CC(C)Cc1ccc(C(=O)CCC(=O)NC2CCN(C(=O)C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C26H38N2O3/c1-19(2)18-20-8-10-21(11-9-20)24(29)12-13-25(30)27-23-14-16-28(17-15-23)26(31)22-6-4-3-5-7-22/h8-11,19,22-23H,3-7,12-18H2,1-2H3,(H,27,30) |
| InChIKey | KTMDZNWPHWWLQW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |