C22H31N3O4S — CID 55690965
N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-(cyclopropylsulfamoyl)benzamide (PubChem CID 55690965) has the molecular formula C22H31N3O4S and a molecular weight of 433.57 g/mol. Its IUPAC name is N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-(cyclopropylsulfamoyl)benzamide.
| Compound Name | N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-(cyclopropylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55690965 |
| Molecular Formula | C22H31N3O4S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-(cyclopropylsulfamoyl)benzamide |
| SMILES | O=C(NC1CCN(C(=O)C2CCCCC2)CC1)c1cccc(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C22H31N3O4S/c26-21(17-7-4-8-20(15-17)30(28,29)24-19-9-10-19)23-18-11-13-25(14-12-18)22(27)16-5-2-1-3-6-16/h4,7-8,15-16,18-19,24H,1-3,5-6,9-14H2,(H,23,26) |
| InChIKey | DVVPUKRBBXTXGI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |