C19H23N3O4 — CID 55697500
2-methoxy-N-[4-[[4-(methoxymethyl)phenyl]methylcarbamoylamino]phenyl]acetamide (PubChem CID 55697500) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-methoxy-N-[4-[[4-(methoxymethyl)phenyl]methylcarbamoylamino]phenyl]acetamide.
| Compound Name | 2-methoxy-N-[4-[[4-(methoxymethyl)phenyl]methylcarbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 55697500 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-methoxy-N-[4-[[4-(methoxymethyl)phenyl]methylcarbamoylamino]phenyl]acetamide |
| SMILES | COCC(=O)Nc1ccc(NC(=O)NCc2ccc(COC)cc2)cc1 |
| InChI | InChI=1S/C19H23N3O4/c1-25-12-15-5-3-14(4-6-15)11-20-19(24)22-17-9-7-16(8-10-17)21-18(23)13-26-2/h3-10H,11-13H2,1-2H3,(H,21,23)(H2,20,22,24) |
| InChIKey | NIMHZSUJQBLHSO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |