C17H17Cl2N3O3 — CID 55697658
N-[4-[(2,4-dichlorophenyl)methylcarbamoylamino]phenyl]-2-methoxyacetamide (PubChem CID 55697658) has the molecular formula C17H17Cl2N3O3 and a molecular weight of 382.25 g/mol. Its IUPAC name is N-[4-[(2,4-dichlorophenyl)methylcarbamoylamino]phenyl]-2-methoxyacetamide.
| Compound Name | N-[4-[(2,4-dichlorophenyl)methylcarbamoylamino]phenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 55697658 |
| Molecular Formula | C17H17Cl2N3O3 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | N-[4-[(2,4-dichlorophenyl)methylcarbamoylamino]phenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(NC(=O)NCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl2N3O3/c1-25-10-16(23)21-13-4-6-14(7-5-13)22-17(24)20-9-11-2-3-12(18)8-15(11)19/h2-8H,9-10H2,1H3,(H,21,23)(H2,20,22,24) |
| InChIKey | BCJYIWCSWLMTEW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |