C20H18F2N2O3S — CID 55698190
3,4-difluoro-N-[1-[4-(pyridin-3-ylmethoxy)phenyl]ethyl]benzenesulfonamide (PubChem CID 55698190) has the molecular formula C20H18F2N2O3S and a molecular weight of 404.44 g/mol. Its IUPAC name is 3,4-difluoro-N-[1-[4-(pyridin-3-ylmethoxy)phenyl]ethyl]benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-[1-[4-(pyridin-3-ylmethoxy)phenyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55698190 |
| Molecular Formula | C20H18F2N2O3S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 3,4-difluoro-N-[1-[4-(pyridin-3-ylmethoxy)phenyl]ethyl]benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(F)c(F)c1)c1ccc(OCc2cccnc2)cc1 |
| InChI | InChI=1S/C20H18F2N2O3S/c1-14(24-28(25,26)18-8-9-19(21)20(22)11-18)16-4-6-17(7-5-16)27-13-15-3-2-10-23-12-15/h2-12,14,24H,13H2,1H3 |
| InChIKey | WLGPTFKSKVLCAA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |