C22H21N5O4 — CID 55700272
2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]acetamide (PubChem CID 55700272) has the molecular formula C22H21N5O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]acetamide.
| Compound Name | 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55700272 |
| Molecular Formula | C22H21N5O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]acetamide |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)Nc2ccccc2-c2noc(C)n2)C1=O |
| InChI | InChI=1S/C22H21N5O4/c1-3-22(15-9-5-4-6-10-15)20(29)27(21(30)25-22)13-18(28)24-17-12-8-7-11-16(17)19-23-14(2)31-26-19/h4-12H,3,13H2,1-2H3,(H,24,28)(H,25,30) |
| InChIKey | HUQGWMJKRZIYKK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|