C27H33N3O4 — CID 55700357
tert-butyl N-ethyl-N-[[2-[3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enoylamino]phenyl]methyl]carbamate (PubChem CID 55700357) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[[2-[3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enoylamino]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[[2-[3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enoylamino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 55700357 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | tert-butyl N-ethyl-N-[[2-[3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enoylamino]phenyl]methyl]carbamate |
| SMILES | CCN(Cc1ccccc1NC(=O)C=Cc1ccc(N2CCCC2=O)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H33N3O4/c1-5-29(26(33)34-27(2,3)4)19-21-9-6-7-10-23(21)28-24(31)17-14-20-12-15-22(16-13-20)30-18-8-11-25(30)32/h6-7,9-10,12-17H,5,8,11,18-19H2,1-4H3,(H,28,31) |
| InChIKey | AUSPVAXNRNTLOB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|