C20H19N5O5 — CID 55700716
N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 55700716) has the molecular formula C20H19N5O5 and a molecular weight of 409.40 g/mol. Its IUPAC name is N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 55700716 |
| Molecular Formula | C20H19N5O5 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | Cc1nc(-c2ccccc2NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)no1 |
| InChI | InChI=1S/C20H19N5O5/c1-13-21-19(23-30-13)15-4-2-3-5-17(15)22-20(26)16-12-14(25(27)28)6-7-18(16)24-8-10-29-11-9-24/h2-7,12H,8-11H2,1H3,(H,22,26) |
| InChIKey | ZORCVCWXKINLNV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|