C23H23N7O5 — CID 55700846
N-[6-(3-carbamoylpiperidin-1-yl)-3-pyridinyl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide (PubChem CID 55700846) has the molecular formula C23H23N7O5 and a molecular weight of 477.48 g/mol. Its IUPAC name is N-[6-(3-carbamoylpiperidin-1-yl)-3-pyridinyl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide.
| Compound Name | N-[6-(3-carbamoylpiperidin-1-yl)-3-pyridinyl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55700846 |
| Molecular Formula | C23H23N7O5 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-[6-(3-carbamoylpiperidin-1-yl)-3-pyridinyl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)Nc2ccc(N3CCCC(C(N)=O)C3)nc2)nn1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H23N7O5/c1-14-11-19(31)21(27-29(14)17-6-2-3-7-18(17)30(34)35)23(33)26-16-8-9-20(25-12-16)28-10-4-5-15(13-28)22(24)32/h2-3,6-9,11-12,15H,4-5,10,13H2,1H3,(H2,24,32)(H,26,33) |
| InChIKey | LYYMCCVEAFOJJB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 166.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|