C22H20N4O4 — CID 7678371
6-methyl-1-(2-nitrophenyl)-4-oxo-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyridazine-3-carboxamide (PubChem CID 7678371) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is 6-methyl-1-(2-nitrophenyl)-4-oxo-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyridazine-3-carboxamide.
| Compound Name | 6-methyl-1-(2-nitrophenyl)-4-oxo-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 7678371 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 6-methyl-1-(2-nitrophenyl)-4-oxo-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)N[C@@H]2CCCc3ccccc32)nn1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H20N4O4/c1-14-13-20(27)21(24-25(14)18-11-4-5-12-19(18)26(29)30)22(28)23-17-10-6-8-15-7-2-3-9-16(15)17/h2-5,7,9,11-13,17H,6,8,10H2,1H3,(H,23,28)/t17-/m1/s1 |
| InChIKey | WFBBEVJVGOPQIV-QGZVFWFLSA-N |
| XLogP | 3.26 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|