C22H20ClF3N4O2 — CID 55702683
2-(4-chlorophenyl)-N'-[2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]acetyl]acetohydrazide (PubChem CID 55702683) has the molecular formula C22H20ClF3N4O2 and a molecular weight of 464.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N'-[2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]acetyl]acetohydrazide.
| Compound Name | 2-(4-chlorophenyl)-N'-[2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]acetyl]acetohydrazide |
|---|---|
| PubChem CID | 55702683 |
| Molecular Formula | C22H20ClF3N4O2 |
| Molecular Weight | 464.88 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 2-(4-chlorophenyl)-N'-[2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]acetyl]acetohydrazide |
| SMILES | Cc1nn(-c2cccc(C(F)(F)F)c2)c(C)c1CC(=O)NNC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20ClF3N4O2/c1-13-19(12-21(32)28-27-20(31)10-15-6-8-17(23)9-7-15)14(2)30(29-13)18-5-3-4-16(11-18)22(24,25)26/h3-9,11H,10,12H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | BDXBHUFUFJDPGM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.88 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|