C17H16F3N7O2 — CID 86892302
N'-[2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]acetyl]-2H-triazole-4-carbohydrazide (PubChem CID 86892302) has the molecular formula C17H16F3N7O2 and a molecular weight of 407.36 g/mol. Its IUPAC name is N'-[2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]acetyl]-2H-triazole-4-carbohydrazide.
| Compound Name | N'-[2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]acetyl]-2H-triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 86892302 |
| Molecular Formula | C17H16F3N7O2 |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N'-[2-[3,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]acetyl]-2H-triazole-4-carbohydrazide |
| SMILES | Cc1nn(-c2cccc(C(F)(F)F)c2)c(C)c1CC(=O)NNC(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C17H16F3N7O2/c1-9-13(7-15(28)23-24-16(29)14-8-21-26-22-14)10(2)27(25-9)12-5-3-4-11(6-12)17(18,19)20/h3-6,8H,7H2,1-2H3,(H,23,28)(H,24,29)(H,21,22,26) |
| InChIKey | DNONPNWQVZAQNM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|