C18H22N4O3S — CID 55703070
N-[4-[1-[4-(carbamoylamino)phenyl]ethylamino]-4-oxobutyl]thiophene-2-carboxamide (PubChem CID 55703070) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is N-[4-[1-[4-(carbamoylamino)phenyl]ethylamino]-4-oxobutyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[1-[4-(carbamoylamino)phenyl]ethylamino]-4-oxobutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55703070 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[4-[1-[4-(carbamoylamino)phenyl]ethylamino]-4-oxobutyl]thiophene-2-carboxamide |
| SMILES | CC(NC(=O)CCCNC(=O)c1cccs1)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C18H22N4O3S/c1-12(13-6-8-14(9-7-13)22-18(19)25)21-16(23)5-2-10-20-17(24)15-4-3-11-26-15/h3-4,6-9,11-12H,2,5,10H2,1H3,(H,20,24)(H,21,23)(H3,19,22,25) |
| InChIKey | KHKSHLQECGROMT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|