C14H22N4O2 — CID 62832500
N-[1-[4-(carbamoylamino)phenyl]ethyl]-3-(ethylamino)propanamide (PubChem CID 62832500) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[1-[4-(carbamoylamino)phenyl]ethyl]-3-(ethylamino)propanamide.
| Compound Name | N-[1-[4-(carbamoylamino)phenyl]ethyl]-3-(ethylamino)propanamide |
|---|---|
| PubChem CID | 62832500 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | N-[1-[4-(carbamoylamino)phenyl]ethyl]-3-(ethylamino)propanamide |
| SMILES | CCNCCC(=O)NC(C)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C14H22N4O2/c1-3-16-9-8-13(19)17-10(2)11-4-6-12(7-5-11)18-14(15)20/h4-7,10,16H,3,8-9H2,1-2H3,(H,17,19)(H3,15,18,20) |
| InChIKey | QDRSIMVAUGJBTR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|