C18H18Br2N2O2S — CID 55704272
N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(2-bromophenyl)sulfanylpropanamide (PubChem CID 55704272) has the molecular formula C18H18Br2N2O2S and a molecular weight of 486.23 g/mol. Its IUPAC name is N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(2-bromophenyl)sulfanylpropanamide.
| Compound Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(2-bromophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 55704272 |
| Molecular Formula | C18H18Br2N2O2S |
| Molecular Weight | 486.23 g/mol |
| Exact Mass | 483.95 |
| IUPAC Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(2-bromophenyl)sulfanylpropanamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNC(=O)CCSc1ccccc1Br |
| InChI | InChI=1S/C18H18Br2N2O2S/c1-12-10-13(19)6-7-15(12)22-18(24)11-21-17(23)8-9-25-16-5-3-2-4-14(16)20/h2-7,10H,8-9,11H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | VVQGKNQYVMCYIF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.23 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |