C25H26BrN3O2 — CID 16561679
N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-2-(1,2-diphenylethylamino)acetamide (PubChem CID 16561679) has the molecular formula C25H26BrN3O2 and a molecular weight of 480.41 g/mol. Its IUPAC name is N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-2-(1,2-diphenylethylamino)acetamide.
| Compound Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-2-(1,2-diphenylethylamino)acetamide |
|---|---|
| PubChem CID | 16561679 |
| Molecular Formula | C25H26BrN3O2 |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-2-(1,2-diphenylethylamino)acetamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNC(=O)CNC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26BrN3O2/c1-18-14-21(26)12-13-22(18)29-25(31)17-28-24(30)16-27-23(20-10-6-3-7-11-20)15-19-8-4-2-5-9-19/h2-14,23,27H,15-17H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | BVBBFHNFNDRTPK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |